C31H34FNO7 — CID 54765150
(2S)-2-[(3-fluoro-4-methoxybenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid (PubChem CID 54765150) has the molecular formula C31H34FNO7 and a molecular weight of 551.61 g/mol. Its IUPAC name is (2S)-2-[(3-fluoro-4-methoxybenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid.
| Compound Name | (2S)-2-[(3-fluoro-4-methoxybenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 54765150 |
| Molecular Formula | C31H34FNO7 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | (2S)-2-[(3-fluoro-4-methoxybenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(OC)c(F)c3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C31H34FNO7/c1-3-4-5-6-7-18-39-24-15-10-22(11-16-24)31(37)40-25-13-8-21(9-14-25)19-27(30(35)36)33-29(34)23-12-17-28(38-2)26(32)20-23/h8-17,20,27H,3-7,18-19H2,1-2H3,(H,33,34)(H,35,36)/t27-/m0/s1 |
| InChIKey | HMZYASMFOPRDCG-MHZLTWQESA-N |
| XLogP | 5.83 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|