C36H44N2O8 — CID 58546109
2-[[3-(2,2-dimethylpropanoylamino)benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid (PubChem CID 58546109) has the molecular formula C36H44N2O8 and a molecular weight of 632.75 g/mol. Its IUPAC name is 2-[[3-(2,2-dimethylpropanoylamino)benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid.
| Compound Name | 2-[[3-(2,2-dimethylpropanoylamino)benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 58546109 |
| Molecular Formula | C36H44N2O8 |
| Molecular Weight | 632.75 g/mol |
| Exact Mass | 632.31 |
| IUPAC Name | 2-[[3-(2,2-dimethylpropanoylamino)benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CC(NC(=O)c3cccc(NC(=O)C(C)(C)C)c3)C(=O)O)cc2OC)cc1 |
| InChI | InChI=1S/C36H44N2O8/c1-6-7-8-9-10-20-45-28-17-15-25(16-18-28)34(42)46-30-19-14-24(22-31(30)44-5)21-29(33(40)41)38-32(39)26-12-11-13-27(23-26)37-35(43)36(2,3)4/h11-19,22-23,29H,6-10,20-21H2,1-5H3,(H,37,43)(H,38,39)(H,40,41) |
| InChIKey | PXHZIEHAPYGJSR-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.75 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|