C37H43N3O9 — CID 123662223
2-[[3-[(3,5-dimethyl-2,3-dihydro-1,2-oxazole-4-carbonyl)amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid (PubChem CID 123662223) has the molecular formula C37H43N3O9 and a molecular weight of 673.76 g/mol. Its IUPAC name is 2-[[3-[(3,5-dimethyl-2,3-dihydro-1,2-oxazole-4-carbonyl)amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid.
| Compound Name | 2-[[3-[(3,5-dimethyl-2,3-dihydro-1,2-oxazole-4-carbonyl)amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 123662223 |
| Molecular Formula | C37H43N3O9 |
| Molecular Weight | 673.76 g/mol |
| Exact Mass | 673.30 |
| IUPAC Name | 2-[[3-[(3,5-dimethyl-2,3-dihydro-1,2-oxazole-4-carbonyl)amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CC(NC(=O)c3cccc(NC(=O)C4=C(C)ONC4C)c3)C(=O)O)cc2OC)cc1 |
| InChI | InChI=1S/C37H43N3O9/c1-5-6-7-8-9-19-47-29-16-14-26(15-17-29)37(45)48-31-18-13-25(21-32(31)46-4)20-30(36(43)44)39-34(41)27-11-10-12-28(22-27)38-35(42)33-23(2)40-49-24(33)3/h10-18,21-23,30,40H,5-9,19-20H2,1-4H3,(H,38,42)(H,39,41)(H,43,44) |
| InChIKey | NHGGVXAYUYEKTG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 161.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.76 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|