C34H40N2O8 — CID 58545968
3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]-2-[[3-(propanoylamino)benzoyl]amino]propanoic acid (PubChem CID 58545968) has the molecular formula C34H40N2O8 and a molecular weight of 604.70 g/mol. Its IUPAC name is 3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]-2-[[3-(propanoylamino)benzoyl]amino]propanoic acid.
| Compound Name | 3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]-2-[[3-(propanoylamino)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58545968 |
| Molecular Formula | C34H40N2O8 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | 3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]-2-[[3-(propanoylamino)benzoyl]amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CC(NC(=O)c3cccc(NC(=O)CC)c3)C(=O)O)cc2OC)cc1 |
| InChI | InChI=1S/C34H40N2O8/c1-4-6-7-8-9-19-43-27-16-14-24(15-17-27)34(41)44-29-18-13-23(21-30(29)42-3)20-28(33(39)40)36-32(38)25-11-10-12-26(22-25)35-31(37)5-2/h10-18,21-22,28H,4-9,19-20H2,1-3H3,(H,35,37)(H,36,38)(H,39,40) |
| InChIKey | WZIBWSVUMZQMQS-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|