C39H42N2O9 — CID 58546067
3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]-2-[[4-[(2-phenoxyacetyl)amino]benzoyl]amino]propanoic acid (PubChem CID 58546067) has the molecular formula C39H42N2O9 and a molecular weight of 682.77 g/mol. Its IUPAC name is 3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]-2-[[4-[(2-phenoxyacetyl)amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]-2-[[4-[(2-phenoxyacetyl)amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58546067 |
| Molecular Formula | C39H42N2O9 |
| Molecular Weight | 682.77 g/mol |
| Exact Mass | 682.29 |
| IUPAC Name | 3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]-2-[[4-[(2-phenoxyacetyl)amino]benzoyl]amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CC(NC(=O)c3ccc(NC(=O)COc4ccccc4)cc3)C(=O)O)cc2OC)cc1 |
| InChI | InChI=1S/C39H42N2O9/c1-3-4-5-6-10-23-48-32-20-16-29(17-21-32)39(46)50-34-22-13-27(25-35(34)47-2)24-33(38(44)45)41-37(43)28-14-18-30(19-15-28)40-36(42)26-49-31-11-8-7-9-12-31/h7-9,11-22,25,33H,3-6,10,23-24,26H2,1-2H3,(H,40,42)(H,41,43)(H,44,45) |
| InChIKey | UKTXVPAACFWUCN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.77 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|