C34H40N2O9 — CID 58546075
3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]-2-[[3-[(2-methoxyacetyl)amino]benzoyl]amino]propanoic acid (PubChem CID 58546075) has the molecular formula C34H40N2O9 and a molecular weight of 620.70 g/mol. Its IUPAC name is 3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]-2-[[3-[(2-methoxyacetyl)amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]-2-[[3-[(2-methoxyacetyl)amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58546075 |
| Molecular Formula | C34H40N2O9 |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | 3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]-2-[[3-[(2-methoxyacetyl)amino]benzoyl]amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CC(NC(=O)c3cccc(NC(=O)COC)c3)C(=O)O)cc2OC)cc1 |
| InChI | InChI=1S/C34H40N2O9/c1-4-5-6-7-8-18-44-27-15-13-24(14-16-27)34(41)45-29-17-12-23(20-30(29)43-3)19-28(33(39)40)36-32(38)25-10-9-11-26(21-25)35-31(37)22-42-2/h9-17,20-21,28H,4-8,18-19,22H2,1-3H3,(H,35,37)(H,36,38)(H,39,40) |
| InChIKey | KGALMCQCPQVDSD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|