C38H39FN2O8 — CID 58545918
2-[[3-[(4-fluorobenzoyl)amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid (PubChem CID 58545918) has the molecular formula C38H39FN2O8 and a molecular weight of 670.73 g/mol. Its IUPAC name is 2-[[3-[(4-fluorobenzoyl)amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid.
| Compound Name | 2-[[3-[(4-fluorobenzoyl)amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 58545918 |
| Molecular Formula | C38H39FN2O8 |
| Molecular Weight | 670.73 g/mol |
| Exact Mass | 670.27 |
| IUPAC Name | 2-[[3-[(4-fluorobenzoyl)amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CC(NC(=O)c3cccc(NC(=O)c4ccc(F)cc4)c3)C(=O)O)cc2OC)cc1 |
| InChI | InChI=1S/C38H39FN2O8/c1-3-4-5-6-7-21-48-31-18-14-27(15-19-31)38(46)49-33-20-11-25(23-34(33)47-2)22-32(37(44)45)41-36(43)28-9-8-10-30(24-28)40-35(42)26-12-16-29(39)17-13-26/h8-20,23-24,32H,3-7,21-22H2,1-2H3,(H,40,42)(H,41,43)(H,44,45) |
| InChIKey | MAFXHKKWHLMTMR-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.73 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|