C34H40N2O7 — CID 58545756
[4-[2-[(3-acetamidobenzoyl)amino]-3-oxobutyl]-2-methoxyphenyl] 4-heptoxybenzoate (PubChem CID 58545756) has the molecular formula C34H40N2O7 and a molecular weight of 588.70 g/mol. Its IUPAC name is [4-[2-[(3-acetamidobenzoyl)amino]-3-oxobutyl]-2-methoxyphenyl] 4-heptoxybenzoate.
| Compound Name | [4-[2-[(3-acetamidobenzoyl)amino]-3-oxobutyl]-2-methoxyphenyl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 58545756 |
| Molecular Formula | C34H40N2O7 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | [4-[2-[(3-acetamidobenzoyl)amino]-3-oxobutyl]-2-methoxyphenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CC(NC(=O)c3cccc(NC(C)=O)c3)C(C)=O)cc2OC)cc1 |
| InChI | InChI=1S/C34H40N2O7/c1-5-6-7-8-9-19-42-29-16-14-26(15-17-29)34(40)43-31-18-13-25(21-32(31)41-4)20-30(23(2)37)36-33(39)27-11-10-12-28(22-27)35-24(3)38/h10-18,21-22,30H,5-9,19-20H2,1-4H3,(H,35,38)(H,36,39) |
| InChIKey | PJWJMSDJNIGSJC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|