C39H44N2O8 — CID 58545604
[4-[2-[[4-[(2,5-dimethylfuran-3-carbonyl)amino]benzoyl]amino]-3-oxobutyl]-2-methoxyphenyl] 4-heptoxybenzoate (PubChem CID 58545604) has the molecular formula C39H44N2O8 and a molecular weight of 668.79 g/mol. Its IUPAC name is [4-[2-[[4-[(2,5-dimethylfuran-3-carbonyl)amino]benzoyl]amino]-3-oxobutyl]-2-methoxyphenyl] 4-heptoxybenzoate.
| Compound Name | [4-[2-[[4-[(2,5-dimethylfuran-3-carbonyl)amino]benzoyl]amino]-3-oxobutyl]-2-methoxyphenyl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 58545604 |
| Molecular Formula | C39H44N2O8 |
| Molecular Weight | 668.79 g/mol |
| Exact Mass | 668.31 |
| IUPAC Name | [4-[2-[[4-[(2,5-dimethylfuran-3-carbonyl)amino]benzoyl]amino]-3-oxobutyl]-2-methoxyphenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CC(NC(=O)c3ccc(NC(=O)c4cc(C)oc4C)cc3)C(C)=O)cc2OC)cc1 |
| InChI | InChI=1S/C39H44N2O8/c1-6-7-8-9-10-21-47-32-18-14-30(15-19-32)39(45)49-35-20-11-28(24-36(35)46-5)23-34(26(3)42)41-37(43)29-12-16-31(17-13-29)40-38(44)33-22-25(2)48-27(33)4/h11-20,22,24,34H,6-10,21,23H2,1-5H3,(H,40,44)(H,41,43) |
| InChIKey | XSYQTOHOLKKOHO-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.79 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|