C40H40N2O8S — CID 58545942
2-[[4-(1-benzothiophene-2-carbonylamino)benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid (PubChem CID 58545942) has the molecular formula C40H40N2O8S and a molecular weight of 708.83 g/mol. Its IUPAC name is 2-[[4-(1-benzothiophene-2-carbonylamino)benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid.
| Compound Name | 2-[[4-(1-benzothiophene-2-carbonylamino)benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 58545942 |
| Molecular Formula | C40H40N2O8S |
| Molecular Weight | 708.83 g/mol |
| Exact Mass | 708.25 |
| IUPAC Name | 2-[[4-(1-benzothiophene-2-carbonylamino)benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxy-3-methoxyphenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CC(NC(=O)c3ccc(NC(=O)c4cc5ccccc5s4)cc3)C(=O)O)cc2OC)cc1 |
| InChI | InChI=1S/C40H40N2O8S/c1-3-4-5-6-9-22-49-31-19-15-28(16-20-31)40(47)50-33-21-12-26(24-34(33)48-2)23-32(39(45)46)42-37(43)27-13-17-30(18-14-27)41-38(44)36-25-29-10-7-8-11-35(29)51-36/h7-8,10-21,24-25,32H,3-6,9,22-23H2,1-2H3,(H,41,44)(H,42,43)(H,45,46) |
| InChIKey | URNXRNQSEDXJFG-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.83 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|