C41H42N2O7S — CID 58545817
[4-[2-[[3-(1-benzothiophene-2-carbonylamino)benzoyl]amino]-3-oxobutyl]-2-methoxyphenyl] 4-heptoxybenzoate (PubChem CID 58545817) has the molecular formula C41H42N2O7S and a molecular weight of 706.86 g/mol. Its IUPAC name is [4-[2-[[3-(1-benzothiophene-2-carbonylamino)benzoyl]amino]-3-oxobutyl]-2-methoxyphenyl] 4-heptoxybenzoate.
| Compound Name | [4-[2-[[3-(1-benzothiophene-2-carbonylamino)benzoyl]amino]-3-oxobutyl]-2-methoxyphenyl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 58545817 |
| Molecular Formula | C41H42N2O7S |
| Molecular Weight | 706.86 g/mol |
| Exact Mass | 706.27 |
| IUPAC Name | [4-[2-[[3-(1-benzothiophene-2-carbonylamino)benzoyl]amino]-3-oxobutyl]-2-methoxyphenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CC(NC(=O)c3cccc(NC(=O)c4cc5ccccc5s4)c3)C(C)=O)cc2OC)cc1 |
| InChI | InChI=1S/C41H42N2O7S/c1-4-5-6-7-10-22-49-33-19-17-29(18-20-33)41(47)50-35-21-16-28(24-36(35)48-3)23-34(27(2)44)43-39(45)31-13-11-14-32(25-31)42-40(46)38-26-30-12-8-9-15-37(30)51-38/h8-9,11-21,24-26,34H,4-7,10,22-23H2,1-3H3,(H,42,46)(H,43,45) |
| InChIKey | ODTOLIGCNYKIRJ-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.86 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|