C31H34ClNO6 — CID 58545743
(2S)-2-[(4-chloro-2-methylbenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid (PubChem CID 58545743) has the molecular formula C31H34ClNO6 and a molecular weight of 552.07 g/mol. Its IUPAC name is (2S)-2-[(4-chloro-2-methylbenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid.
| Compound Name | (2S)-2-[(4-chloro-2-methylbenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 58545743 |
| Molecular Formula | C31H34ClNO6 |
| Molecular Weight | 552.07 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | (2S)-2-[(4-chloro-2-methylbenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(Cl)cc3C)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C31H34ClNO6/c1-3-4-5-6-7-18-38-25-15-10-23(11-16-25)31(37)39-26-13-8-22(9-14-26)20-28(30(35)36)33-29(34)27-17-12-24(32)19-21(27)2/h8-17,19,28H,3-7,18,20H2,1-2H3,(H,33,34)(H,35,36)/t28-/m0/s1 |
| InChIKey | FJZIIWCLOXWEND-NDEPHWFRSA-N |
| XLogP | 6.64 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.07 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|