C32H37NO6 — CID 54764374
(2S)-2-[(2,5-dimethylbenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid (PubChem CID 54764374) has the molecular formula C32H37NO6 and a molecular weight of 531.65 g/mol. Its IUPAC name is (2S)-2-[(2,5-dimethylbenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid.
| Compound Name | (2S)-2-[(2,5-dimethylbenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 54764374 |
| Molecular Formula | C32H37NO6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | (2S)-2-[(2,5-dimethylbenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3cc(C)ccc3C)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C32H37NO6/c1-4-5-6-7-8-19-38-26-17-13-25(14-18-26)32(37)39-27-15-11-24(12-16-27)21-29(31(35)36)33-30(34)28-20-22(2)9-10-23(28)3/h9-18,20,29H,4-8,19,21H2,1-3H3,(H,33,34)(H,35,36)/t29-/m0/s1 |
| InChIKey | IGSYALSHQDESAK-LJAQVGFWSA-N |
| XLogP | 6.30 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|