C39H41ClN2O6 — CID 58546102
[4-[(2S)-2-[[4-[[2-(3-chlorophenyl)acetyl]amino]benzoyl]amino]-3-oxobutyl]phenyl] 4-heptoxybenzoate (PubChem CID 58546102) has the molecular formula C39H41ClN2O6 and a molecular weight of 669.22 g/mol. Its IUPAC name is [4-[(2S)-2-[[4-[[2-(3-chlorophenyl)acetyl]amino]benzoyl]amino]-3-oxobutyl]phenyl] 4-heptoxybenzoate.
| Compound Name | [4-[(2S)-2-[[4-[[2-(3-chlorophenyl)acetyl]amino]benzoyl]amino]-3-oxobutyl]phenyl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 58546102 |
| Molecular Formula | C39H41ClN2O6 |
| Molecular Weight | 669.22 g/mol |
| Exact Mass | 668.27 |
| IUPAC Name | [4-[(2S)-2-[[4-[[2-(3-chlorophenyl)acetyl]amino]benzoyl]amino]-3-oxobutyl]phenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(NC(=O)Cc4cccc(Cl)c4)cc3)C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C39H41ClN2O6/c1-3-4-5-6-7-23-47-34-21-15-31(16-22-34)39(46)48-35-19-11-28(12-20-35)25-36(27(2)43)42-38(45)30-13-17-33(18-14-30)41-37(44)26-29-9-8-10-32(40)24-29/h8-22,24,36H,3-7,23,25-26H2,1-2H3,(H,41,44)(H,42,45)/t36-/m0/s1 |
| InChIKey | WOMSSGGTIFZLTF-BHVANESWSA-N |
| XLogP | 8.02 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.22 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|