C41H45N3O9 — CID 58545901
2-[[(2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[(2-phenylmethoxyacetyl)amino]benzoyl]amino]propanoyl]amino]acetic acid (PubChem CID 58545901) has the molecular formula C41H45N3O9 and a molecular weight of 723.82 g/mol. Its IUPAC name is 2-[[(2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[(2-phenylmethoxyacetyl)amino]benzoyl]amino]propanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[(2-phenylmethoxyacetyl)amino]benzoyl]amino]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 58545901 |
| Molecular Formula | C41H45N3O9 |
| Molecular Weight | 723.82 g/mol |
| Exact Mass | 723.32 |
| IUPAC Name | 2-[[(2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[(2-phenylmethoxyacetyl)amino]benzoyl]amino]propanoyl]amino]acetic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(NC(=O)COCc4ccccc4)cc3)C(=O)NCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C41H45N3O9/c1-2-3-4-5-9-24-52-34-22-16-32(17-23-34)41(50)53-35-20-12-29(13-21-35)25-36(40(49)42-26-38(46)47)44-39(48)31-14-18-33(19-15-31)43-37(45)28-51-27-30-10-7-6-8-11-30/h6-8,10-23,36H,2-5,9,24-28H2,1H3,(H,42,49)(H,43,45)(H,44,48)(H,46,47)/t36-/m0/s1 |
| InChIKey | LHVGFEFTIASVLR-BHVANESWSA-N |
| XLogP | 5.95 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.82 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|