C42H47N3O9 — CID 76818980
2-[[3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]propanoyl]amino]propanoic acid (PubChem CID 76818980) has the molecular formula C42H47N3O9 and a molecular weight of 737.85 g/mol. Its IUPAC name is 2-[[3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]propanoyl]amino]propanoic acid.
| Compound Name | 2-[[3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 76818980 |
| Molecular Formula | C42H47N3O9 |
| Molecular Weight | 737.85 g/mol |
| Exact Mass | 737.33 |
| IUPAC Name | 2-[[3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]propanoyl]amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CC(NC(=O)c3ccc(NC(=O)Cc4ccc(OC)cc4)cc3)C(=O)NC(C)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C42H47N3O9/c1-4-5-6-7-8-25-53-35-23-15-32(16-24-35)42(51)54-36-21-11-29(12-22-36)26-37(40(48)43-28(2)41(49)50)45-39(47)31-13-17-33(18-14-31)44-38(46)27-30-9-19-34(52-3)20-10-30/h9-24,28,37H,4-8,25-27H2,1-3H3,(H,43,48)(H,44,46)(H,45,47)(H,49,50) |
| InChIKey | AEUWNPNHLFEKTB-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.85 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|