C41H46N2O8 — CID 58545929
[4-[(2S)-2-[[4-[[2-(2,3-dimethoxyphenyl)acetyl]amino]benzoyl]amino]-3-oxobutyl]phenyl] 4-heptoxybenzoate (PubChem CID 58545929) has the molecular formula C41H46N2O8 and a molecular weight of 694.83 g/mol. Its IUPAC name is [4-[(2S)-2-[[4-[[2-(2,3-dimethoxyphenyl)acetyl]amino]benzoyl]amino]-3-oxobutyl]phenyl] 4-heptoxybenzoate.
| Compound Name | [4-[(2S)-2-[[4-[[2-(2,3-dimethoxyphenyl)acetyl]amino]benzoyl]amino]-3-oxobutyl]phenyl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 58545929 |
| Molecular Formula | C41H46N2O8 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 694.33 |
| IUPAC Name | [4-[(2S)-2-[[4-[[2-(2,3-dimethoxyphenyl)acetyl]amino]benzoyl]amino]-3-oxobutyl]phenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(NC(=O)Cc4cccc(OC)c4OC)cc3)C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C41H46N2O8/c1-5-6-7-8-9-25-50-34-23-17-31(18-24-34)41(47)51-35-21-13-29(14-22-35)26-36(28(2)44)43-40(46)30-15-19-33(20-16-30)42-38(45)27-32-11-10-12-37(48-3)39(32)49-4/h10-24,36H,5-9,25-27H2,1-4H3,(H,42,45)(H,43,46)/t36-/m0/s1 |
| InChIKey | NKQDNSOCHRKRSX-BHVANESWSA-N |
| XLogP | 7.38 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|