C46H48N2O7 — CID 58546030
[4-[(2S)-3-oxo-2-[[4-[[2-(2-phenylmethoxyphenyl)acetyl]amino]benzoyl]amino]butyl]phenyl] 4-heptoxybenzoate (PubChem CID 58546030) has the molecular formula C46H48N2O7 and a molecular weight of 740.90 g/mol. Its IUPAC name is [4-[(2S)-3-oxo-2-[[4-[[2-(2-phenylmethoxyphenyl)acetyl]amino]benzoyl]amino]butyl]phenyl] 4-heptoxybenzoate.
| Compound Name | [4-[(2S)-3-oxo-2-[[4-[[2-(2-phenylmethoxyphenyl)acetyl]amino]benzoyl]amino]butyl]phenyl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 58546030 |
| Molecular Formula | C46H48N2O7 |
| Molecular Weight | 740.90 g/mol |
| Exact Mass | 740.35 |
| IUPAC Name | [4-[(2S)-3-oxo-2-[[4-[[2-(2-phenylmethoxyphenyl)acetyl]amino]benzoyl]amino]butyl]phenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(NC(=O)Cc4ccccc4OCc4ccccc4)cc3)C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C46H48N2O7/c1-3-4-5-6-12-29-53-40-27-21-37(22-28-40)46(52)55-41-25-17-34(18-26-41)30-42(33(2)49)48-45(51)36-19-23-39(24-20-36)47-44(50)31-38-15-10-11-16-43(38)54-32-35-13-8-7-9-14-35/h7-11,13-28,42H,3-6,12,29-32H2,1-2H3,(H,47,50)(H,48,51)/t42-/m0/s1 |
| InChIKey | MIMXMCNDFLVNFN-WBCKFURZSA-N |
| XLogP | 8.95 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.90 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|