C38H43N3O8S — CID 58546027
(2S)-3-[4-[(4-heptoxyphenyl)sulfonylamino]phenyl]-2-[[4-[(2-phenylmethoxyacetyl)amino]benzoyl]amino]propanoic acid (PubChem CID 58546027) has the molecular formula C38H43N3O8S and a molecular weight of 701.84 g/mol. Its IUPAC name is (2S)-3-[4-[(4-heptoxyphenyl)sulfonylamino]phenyl]-2-[[4-[(2-phenylmethoxyacetyl)amino]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-[(4-heptoxyphenyl)sulfonylamino]phenyl]-2-[[4-[(2-phenylmethoxyacetyl)amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58546027 |
| Molecular Formula | C38H43N3O8S |
| Molecular Weight | 701.84 g/mol |
| Exact Mass | 701.28 |
| IUPAC Name | (2S)-3-[4-[(4-heptoxyphenyl)sulfonylamino]phenyl]-2-[[4-[(2-phenylmethoxyacetyl)amino]benzoyl]amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(S(=O)(=O)Nc2ccc(C[C@H](NC(=O)c3ccc(NC(=O)COCc4ccccc4)cc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C38H43N3O8S/c1-2-3-4-5-9-24-49-33-20-22-34(23-21-33)50(46,47)41-32-16-12-28(13-17-32)25-35(38(44)45)40-37(43)30-14-18-31(19-15-30)39-36(42)27-48-26-29-10-7-6-8-11-29/h6-8,10-23,35,41H,2-5,9,24-27H2,1H3,(H,39,42)(H,40,43)(H,44,45)/t35-/m0/s1 |
| InChIKey | ORSAERKKTJAMQU-DHUJRADRSA-N |
| XLogP | 6.42 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.84 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|