C40H42N2O7 — CID 58545818
(2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[(1-phenylcyclopropanecarbonyl)amino]benzoyl]amino]propanoic acid (PubChem CID 58545818) has the molecular formula C40H42N2O7 and a molecular weight of 662.78 g/mol. Its IUPAC name is (2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[(1-phenylcyclopropanecarbonyl)amino]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[(1-phenylcyclopropanecarbonyl)amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58545818 |
| Molecular Formula | C40H42N2O7 |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | (2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[(1-phenylcyclopropanecarbonyl)amino]benzoyl]amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(NC(=O)C4(c5ccccc5)CC4)cc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C40H42N2O7/c1-2-3-4-5-9-26-48-33-22-16-30(17-23-33)38(46)49-34-20-12-28(13-21-34)27-35(37(44)45)42-36(43)29-14-18-32(19-15-29)41-39(47)40(24-25-40)31-10-7-6-8-11-31/h6-8,10-23,35H,2-5,9,24-27H2,1H3,(H,41,47)(H,42,43)(H,44,45)/t35-/m0/s1 |
| InChIKey | RRJBTWZZTDVLOR-DHUJRADRSA-N |
| XLogP | 7.35 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|