C39H42N2O7 — CID 123814526
2-[[4-(4-heptoxy-2-methylbenzoyl)oxyphenyl]methyl-[4-(phenacylamino)benzoyl]amino]acetic acid (PubChem CID 123814526) has the molecular formula C39H42N2O7 and a molecular weight of 650.77 g/mol. Its IUPAC name is 2-[[4-(4-heptoxy-2-methylbenzoyl)oxyphenyl]methyl-[4-(phenacylamino)benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-(4-heptoxy-2-methylbenzoyl)oxyphenyl]methyl-[4-(phenacylamino)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 123814526 |
| Molecular Formula | C39H42N2O7 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.30 |
| IUPAC Name | 2-[[4-(4-heptoxy-2-methylbenzoyl)oxyphenyl]methyl-[4-(phenacylamino)benzoyl]amino]acetic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CN(CC(=O)O)C(=O)c3ccc(NCC(=O)c4ccccc4)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C39H42N2O7/c1-3-4-5-6-10-23-47-34-21-22-35(28(2)24-34)39(46)48-33-19-13-29(14-20-33)26-41(27-37(43)44)38(45)31-15-17-32(18-16-31)40-25-36(42)30-11-8-7-9-12-30/h7-9,11-22,24,40H,3-6,10,23,25-27H2,1-2H3,(H,43,44) |
| InChIKey | DPKRWFWNCOLRCL-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|