C30H32N2O7 — CID 71488716
2-[[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]-[[4-(3-methylbutanoyloxy)phenyl]methyl]amino]acetic acid (PubChem CID 71488716) has the molecular formula C30H32N2O7 and a molecular weight of 532.59 g/mol. Its IUPAC name is 2-[[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]-[[4-(3-methylbutanoyloxy)phenyl]methyl]amino]acetic acid.
| Compound Name | 2-[[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]-[[4-(3-methylbutanoyloxy)phenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 71488716 |
| Molecular Formula | C30H32N2O7 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 2-[[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]-[[4-(3-methylbutanoyloxy)phenyl]methyl]amino]acetic acid |
| SMILES | COc1ccc(CC(=O)Nc2ccc(C(=O)N(CC(=O)O)Cc3ccc(OC(=O)CC(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H32N2O7/c1-20(2)16-29(36)39-26-14-6-22(7-15-26)18-32(19-28(34)35)30(37)23-8-10-24(11-9-23)31-27(33)17-21-4-12-25(38-3)13-5-21/h4-15,20H,16-19H2,1-3H3,(H,31,33)(H,34,35) |
| InChIKey | ZNOWTBXORGJIQQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|