C21H26N4O3 — CID 54552676
[4-[butyl(propanoyl)amino]phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 54552676) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is [4-[butyl(propanoyl)amino]phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [4-[butyl(propanoyl)amino]phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 54552676 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | [4-[butyl(propanoyl)amino]phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | CCCCN(C(=O)CC)c1ccc(OC(=O)c2ccc(N=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C21H26N4O3/c1-3-5-14-25(19(26)4-2)17-10-12-18(13-11-17)28-20(27)15-6-8-16(9-7-15)24-21(22)23/h6-13H,3-5,14H2,1-2H3,(H4,22,23,24) |
| InChIKey | ZKZYDBAVNCZITE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|