About [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate
[4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate (PubChem CID 15704049) has the molecular formula C26H28N2O3
and a molecular weight of 416.52 g/mol. Its IUPAC name is [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate.
Molecular Properties
| Compound Name | [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate |
| PubChem CID | 15704049 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate |
| SMILES | CC(C)N1CCN(C(=O)c2ccc(OC(=O)Cc3cccc4ccccc34)cc2)CC1 |
| InChI | InChI=1S/C26H28N2O3/c1-19(2)27-14-16-28(17-15-27)26(30)21-10-12-23(13-11-21)31-25(29)18-22-8-5-7-20-6-3-4-9-24(20)22/h3-13,19H,14-18H2,1-2H3 |
| InChIKey | YATBXYGEHATYES-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate?
The IUPAC name of [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate (CID 15704049) is [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate.
What is the SMILES notation for [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate?
The canonical SMILES for [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate is CC(C)N1CCN(C(=O)c2ccc(OC(=O)Cc3cccc4ccccc34)cc2)CC1.
What is the InChIKey of [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate?
The InChIKey is YATBXYGEHATYES-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N2O3/c1-19(2)27-14-16-28(17-15-27)26(30)21-10-12-23(13-11-21)31-25(29)18-22-8-5-7-20-6-3-4-9-24(20)22/h3-13,19H,14-18H2,1-2H3.
What are the key properties of [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate?
[4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate has a molecular weight of 416.52 g/mol, XLogP of 4.15, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 2-naphthalen-1-ylacetate is sourced from PubChem (CID 15704049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).