C28H31N3O3 — CID 41235170
N-[(2S)-1-(4-benzoylpiperazin-1-yl)-3-methyl-1-oxobutan-2-yl]-2-naphthalen-1-ylacetamide (PubChem CID 41235170) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is N-[(2S)-1-(4-benzoylpiperazin-1-yl)-3-methyl-1-oxobutan-2-yl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(2S)-1-(4-benzoylpiperazin-1-yl)-3-methyl-1-oxobutan-2-yl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 41235170 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | N-[(2S)-1-(4-benzoylpiperazin-1-yl)-3-methyl-1-oxobutan-2-yl]-2-naphthalen-1-ylacetamide |
| SMILES | CC(C)[C@H](NC(=O)Cc1cccc2ccccc12)C(=O)N1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H31N3O3/c1-20(2)26(29-25(32)19-23-13-8-12-21-9-6-7-14-24(21)23)28(34)31-17-15-30(16-18-31)27(33)22-10-4-3-5-11-22/h3-14,20,26H,15-19H2,1-2H3,(H,29,32)/t26-/m0/s1 |
| InChIKey | PNOKXYJUVKYQNL-SANMLTNESA-N |
| XLogP | 3.51 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |