C20H27NO4 — CID 102505804
2-methylnon-4-yn-3-yl 2-(phenylmethoxycarbonylamino)acetate (PubChem CID 102505804) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-methylnon-4-yn-3-yl 2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | 2-methylnon-4-yn-3-yl 2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 102505804 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-methylnon-4-yn-3-yl 2-(phenylmethoxycarbonylamino)acetate |
| SMILES | CCCCC#CC(OC(=O)CNC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C20H27NO4/c1-4-5-6-10-13-18(16(2)3)25-19(22)14-21-20(23)24-15-17-11-8-7-9-12-17/h7-9,11-12,16,18H,4-6,14-15H2,1-3H3,(H,21,23) |
| InChIKey | IGRIXZHHZQLHBY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|