C20H27NO2 — CID 163203647
benzyl (2S,3R)-2-amino-3-methyl-2-prop-2-enylnon-4-ynoate (PubChem CID 163203647) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is benzyl (2S,3R)-2-amino-3-methyl-2-prop-2-enylnon-4-ynoate.
| Compound Name | benzyl (2S,3R)-2-amino-3-methyl-2-prop-2-enylnon-4-ynoate |
|---|---|
| PubChem CID | 163203647 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | benzyl (2S,3R)-2-amino-3-methyl-2-prop-2-enylnon-4-ynoate |
| SMILES | C=CC[C@@](N)(C(=O)OCc1ccccc1)[C@H](C)C#CCCCC |
| InChI | InChI=1S/C20H27NO2/c1-4-6-7-9-12-17(3)20(21,15-5-2)19(22)23-16-18-13-10-8-11-14-18/h5,8,10-11,13-14,17H,2,4,6-7,15-16,21H2,1,3H3/t17-,20+/m1/s1 |
| InChIKey | XHKUBWRZXWOVJC-XLIONFOSSA-N |
| XLogP | 3.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|