C23H35Cl2N3O3 — CID 140980454
benzyl N-[1-(2-aminoethylamino)-3-(2-butoxyphenyl)propan-2-yl]carbamate;dihydrochloride (PubChem CID 140980454) has the molecular formula C23H35Cl2N3O3 and a molecular weight of 472.46 g/mol. Its IUPAC name is benzyl N-[1-(2-aminoethylamino)-3-(2-butoxyphenyl)propan-2-yl]carbamate;dihydrochloride.
| Compound Name | benzyl N-[1-(2-aminoethylamino)-3-(2-butoxyphenyl)propan-2-yl]carbamate;dihydrochloride |
|---|---|
| PubChem CID | 140980454 |
| Molecular Formula | C23H35Cl2N3O3 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | benzyl N-[1-(2-aminoethylamino)-3-(2-butoxyphenyl)propan-2-yl]carbamate;dihydrochloride |
| SMILES | CCCCOc1ccccc1CC(CNCCN)NC(=O)OCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C23H33N3O3.2ClH/c1-2-3-15-28-22-12-8-7-11-20(22)16-21(17-25-14-13-24)26-23(27)29-18-19-9-5-4-6-10-19;;/h4-12,21,25H,2-3,13-18,24H2,1H3,(H,26,27);2*1H |
| InChIKey | OZJWPSKMXNOGLY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|