C26H34N2O5 — CID 173400606
hexyl 3-[[3-oxo-3-phenyl-2-(phenylmethoxycarbonylamino)propyl]amino]propanoate (PubChem CID 173400606) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is hexyl 3-[[3-oxo-3-phenyl-2-(phenylmethoxycarbonylamino)propyl]amino]propanoate.
| Compound Name | hexyl 3-[[3-oxo-3-phenyl-2-(phenylmethoxycarbonylamino)propyl]amino]propanoate |
|---|---|
| PubChem CID | 173400606 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | hexyl 3-[[3-oxo-3-phenyl-2-(phenylmethoxycarbonylamino)propyl]amino]propanoate |
| SMILES | CCCCCCOC(=O)CCNCC(NC(=O)OCc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H34N2O5/c1-2-3-4-11-18-32-24(29)16-17-27-19-23(25(30)22-14-9-6-10-15-22)28-26(31)33-20-21-12-7-5-8-13-21/h5-10,12-15,23,27H,2-4,11,16-20H2,1H3,(H,28,31) |
| InChIKey | DSCPLKMDYPQAJG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|