C17H25N3O4 — CID 90122425
tert-butyl-[1-hydrazinyl-1-oxo-3-(4-prop-2-enoxyphenyl)propan-2-yl]carbamic acid (PubChem CID 90122425) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl-[1-hydrazinyl-1-oxo-3-(4-prop-2-enoxyphenyl)propan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[1-hydrazinyl-1-oxo-3-(4-prop-2-enoxyphenyl)propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 90122425 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | tert-butyl-[1-hydrazinyl-1-oxo-3-(4-prop-2-enoxyphenyl)propan-2-yl]carbamic acid |
| SMILES | C=CCOc1ccc(CC(C(=O)NN)N(C(=O)O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25N3O4/c1-5-10-24-13-8-6-12(7-9-13)11-14(15(21)19-18)20(16(22)23)17(2,3)4/h5-9,14H,1,10-11,18H2,2-4H3,(H,19,21)(H,22,23) |
| InChIKey | LVAHEYQBRTYFPI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|