C27H39N2NaO8 — CID 10459984
sodium [(2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-prop-2-enoxyphenyl)propanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]azanide (PubChem CID 10459984) has the molecular formula C27H39N2NaO8 and a molecular weight of 542.61 g/mol. Its IUPAC name is sodium [(2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-prop-2-enoxyphenyl)propanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]azanide.
| Compound Name | sodium [(2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-prop-2-enoxyphenyl)propanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]azanide |
|---|---|
| PubChem CID | 10459984 |
| Molecular Formula | C27H39N2NaO8 |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | sodium [(2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-prop-2-enoxyphenyl)propanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]azanide |
| SMILES | C=CCOc1ccc(C[C@@H](C(=O)[N-]C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1.[Na+] |
| InChI | InChI=1S/C27H40N2O8.Na/c1-11-16-34-19-14-12-18(13-15-19)17-20(21(30)28-22(31)35-25(2,3)4)29(23(32)36-26(5,6)7)24(33)37-27(8,9)10;/h11-15,20H,1,16-17H2,2-10H3,(H,28,30,31);/q;+1/p-1/t20-;/m0./s1 |
| InChIKey | OABZEFKCHXFTBE-BDQAORGHSA-M |
| XLogP | 3.17 |
| TPSA | 122.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|