C12H17NO3P2 — CID 59990438
(2S)-2-(diphosphanylamino)-3-(4-prop-2-enoxyphenyl)propanoic acid (PubChem CID 59990438) has the molecular formula C12H17NO3P2 and a molecular weight of 285.22 g/mol. Its IUPAC name is (2S)-2-(diphosphanylamino)-3-(4-prop-2-enoxyphenyl)propanoic acid.
| Compound Name | (2S)-2-(diphosphanylamino)-3-(4-prop-2-enoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 59990438 |
| Molecular Formula | C12H17NO3P2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | (2S)-2-(diphosphanylamino)-3-(4-prop-2-enoxyphenyl)propanoic acid |
| SMILES | C=CCOc1ccc(C[C@H](NPP)C(=O)O)cc1 |
| InChI | InChI=1S/C12H17NO3P2/c1-2-7-16-10-5-3-9(4-6-10)8-11(12(14)15)13-18-17/h2-6,11,13,18H,1,7-8,17H2,(H,14,15)/t11-/m0/s1 |
| InChIKey | OOVRTVLIVZYIEQ-NSHDSACASA-N |
| XLogP | 2.22 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|