C13H16N2O4 — CID 90134477
[1-amino-1-oxo-3-(4-prop-2-enoxyphenyl)propan-2-yl]carbamic acid (PubChem CID 90134477) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is [1-amino-1-oxo-3-(4-prop-2-enoxyphenyl)propan-2-yl]carbamic acid.
| Compound Name | [1-amino-1-oxo-3-(4-prop-2-enoxyphenyl)propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 90134477 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | [1-amino-1-oxo-3-(4-prop-2-enoxyphenyl)propan-2-yl]carbamic acid |
| SMILES | C=CCOc1ccc(CC(NC(=O)O)C(N)=O)cc1 |
| InChI | InChI=1S/C13H16N2O4/c1-2-7-19-10-5-3-9(4-6-10)8-11(12(14)16)15-13(17)18/h2-6,11,15H,1,7-8H2,(H2,14,16)(H,17,18) |
| InChIKey | ZRCWDLIBCZXCNL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|