C25H40N4O6 — CID 70298868
tert-butyl N-[(2S)-1-[[(2S)-1-(tert-butylamino)-3-(4-nitrophenyl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-N-methylcarbamate (PubChem CID 70298868) has the molecular formula C25H40N4O6 and a molecular weight of 492.62 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S)-1-(tert-butylamino)-3-(4-nitrophenyl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S)-1-(tert-butylamino)-3-(4-nitrophenyl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 70298868 |
| Molecular Formula | C25H40N4O6 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S)-1-(tert-butylamino)-3-(4-nitrophenyl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-N-methylcarbamate |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](Cc1ccc([N+](=O)[O-])cc1)C(=O)NC(C)(C)C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H40N4O6/c1-16(2)14-20(28(9)23(32)35-25(6,7)8)22(31)26-19(21(30)27-24(3,4)5)15-17-10-12-18(13-11-17)29(33)34/h10-13,16,19-20H,14-15H2,1-9H3,(H,26,31)(H,27,30)/t19-,20-/m0/s1 |
| InChIKey | HKEIBJYBMRWKKT-PMACEKPBSA-N |
| XLogP | 3.82 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|