C13H17ClN2O6S — CID 139765015
propyl (2S)-4-chloro-2-[(4-nitrophenyl)sulfonylamino]butanoate (PubChem CID 139765015) has the molecular formula C13H17ClN2O6S and a molecular weight of 364.81 g/mol. Its IUPAC name is propyl (2S)-4-chloro-2-[(4-nitrophenyl)sulfonylamino]butanoate.
| Compound Name | propyl (2S)-4-chloro-2-[(4-nitrophenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 139765015 |
| Molecular Formula | C13H17ClN2O6S |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | propyl (2S)-4-chloro-2-[(4-nitrophenyl)sulfonylamino]butanoate |
| SMILES | CCCOC(=O)[C@H](CCCl)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H17ClN2O6S/c1-2-9-22-13(17)12(7-8-14)15-23(20,21)11-5-3-10(4-6-11)16(18)19/h3-6,12,15H,2,7-9H2,1H3/t12-/m0/s1 |
| InChIKey | XHQYBGFKKGCJOR-LBPRGKRZSA-N |
| XLogP | 1.82 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|