C14H16BrNO5 — CID 107820705
(2R)-2-[[2-(3-bromophenyl)acetyl]amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107820705) has the molecular formula C14H16BrNO5 and a molecular weight of 358.19 g/mol. Its IUPAC name is (2R)-2-[[2-(3-bromophenyl)acetyl]amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-[[2-(3-bromophenyl)acetyl]amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107820705 |
| Molecular Formula | C14H16BrNO5 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | (2R)-2-[[2-(3-bromophenyl)acetyl]amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NC(=O)Cc1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C14H16BrNO5/c1-21-13(18)6-5-11(14(19)20)16-12(17)8-9-3-2-4-10(15)7-9/h2-4,7,11H,5-6,8H2,1H3,(H,16,17)(H,19,20)/t11-/m1/s1 |
| InChIKey | QKWQHFKWVQXSHC-LLVKDONJSA-N |
| XLogP | 1.51 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |