2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid

C12H20N4O3 — CID 113374875

IUPAC2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid
SMILESCCC(CC)(CC(=O)NCCn1ccnn1)C(=O)O
InChIInChI=1S/C12H20N4O3/c1-3-12(4-2,11(18)19)9-10(17)13-5-7-16-8-6-14-15-16/h6,8H,3-5,7,9H2,1-2H3,(H,13,17)(H,18,19)
InChIKeyMFDMXBCCXDPEFN-UHFFFAOYSA-N
MW268.32 g/mol
LogP0.68
Rot. Bonds8

About 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid

2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid (PubChem CID 113374875) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid.

Molecular Properties

Compound Name2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid
PubChem CID113374875
Molecular FormulaC12H20N4O3
Molecular Weight268.32 g/mol
Exact Mass268.15
IUPAC Name2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid
SMILESCCC(CC)(CC(=O)NCCn1ccnn1)C(=O)O
InChIInChI=1S/C12H20N4O3/c1-3-12(4-2,11(18)19)9-10(17)13-5-7-16-8-6-14-15-16/h6,8H,3-5,7,9H2,1-2H3,(H,13,17)(H,18,19)
InChIKeyMFDMXBCCXDPEFN-UHFFFAOYSA-N
XLogP0.68
TPSA97.11 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.32
LogP ≤ 50.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid?
The IUPAC name of 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid (CID 113374875) is 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid.
What is the SMILES notation for 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid?
The canonical SMILES for 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid is CCC(CC)(CC(=O)NCCn1ccnn1)C(=O)O.
What is the InChIKey of 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid?
The InChIKey is MFDMXBCCXDPEFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O3/c1-3-12(4-2,11(18)19)9-10(17)13-5-7-16-8-6-14-15-16/h6,8H,3-5,7,9H2,1-2H3,(H,13,17)(H,18,19).
What are the key properties of 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid?
2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid has a molecular weight of 268.32 g/mol, XLogP of 0.68, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid is sourced from PubChem (CID 113374875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).