C12H20N4O3 — CID 113374875
2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid (PubChem CID 113374875) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid.
| Compound Name | 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid |
|---|---|
| PubChem CID | 113374875 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2,2-diethyl-4-oxo-4-[2-(triazol-1-yl)ethylamino]butanoic acid |
| SMILES | CCC(CC)(CC(=O)NCCn1ccnn1)C(=O)O |
| InChI | InChI=1S/C12H20N4O3/c1-3-12(4-2,11(18)19)9-10(17)13-5-7-16-8-6-14-15-16/h6,8H,3-5,7,9H2,1-2H3,(H,13,17)(H,18,19) |
| InChIKey | MFDMXBCCXDPEFN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |