C13H22N4O3 — CID 7530166
(2S)-2-(3-imidazol-1-ylpropylcarbamoylamino)-4-methylpentanoic acid (PubChem CID 7530166) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2S)-2-(3-imidazol-1-ylpropylcarbamoylamino)-4-methylpentanoic acid.
| Compound Name | (2S)-2-(3-imidazol-1-ylpropylcarbamoylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 7530166 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (2S)-2-(3-imidazol-1-ylpropylcarbamoylamino)-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)NCCCn1ccnc1)C(=O)O |
| InChI | InChI=1S/C13H22N4O3/c1-10(2)8-11(12(18)19)16-13(20)15-4-3-6-17-7-5-14-9-17/h5,7,9-11H,3-4,6,8H2,1-2H3,(H,18,19)(H2,15,16,20)/t11-/m0/s1 |
| InChIKey | GPJKKMNSKFDLDN-NSHDSACASA-N |
| XLogP | 1.07 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|