C15H28IN7O — CID 110036712
2-[[(cyclopentylamino)-[3-(triazol-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110036712) has the molecular formula C15H28IN7O and a molecular weight of 449.34 g/mol. Its IUPAC name is 2-[[(cyclopentylamino)-[3-(triazol-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(cyclopentylamino)-[3-(triazol-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110036712 |
| Molecular Formula | C15H28IN7O |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-[[(cyclopentylamino)-[3-(triazol-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCCn1ccnn1)NC1CCCC1.I |
| InChI | InChI=1S/C15H27N7O.HI/c1-21(2)14(23)12-17-15(19-13-6-3-4-7-13)16-8-5-10-22-11-9-18-20-22;/h9,11,13H,3-8,10,12H2,1-2H3,(H2,16,17,19);1H |
| InChIKey | RYWBGQKJGUMEPM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|