C15H26IN5O2 — CID 111585740
N,N-dimethyl-2-[[[(3-propan-2-yl-1,2-oxazol-5-yl)methylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111585740) has the molecular formula C15H26IN5O2 and a molecular weight of 435.31 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[(3-propan-2-yl-1,2-oxazol-5-yl)methylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[(3-propan-2-yl-1,2-oxazol-5-yl)methylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111585740 |
| Molecular Formula | C15H26IN5O2 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N,N-dimethyl-2-[[[(3-propan-2-yl-1,2-oxazol-5-yl)methylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NCc1cc(C(C)C)no1.I |
| InChI | InChI=1S/C15H25N5O2.HI/c1-6-7-16-15(18-10-14(21)20(4)5)17-9-12-8-13(11(2)3)19-22-12;/h6,8,11H,1,7,9-10H2,2-5H3,(H2,16,17,18);1H |
| InChIKey | GAAUIDCUMBZUDN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|