C18H29IN4O — CID 111622059
N,N-dimethyl-2-[[[2-(4-methylphenyl)propylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111622059) has the molecular formula C18H29IN4O and a molecular weight of 444.36 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[2-(4-methylphenyl)propylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[2-(4-methylphenyl)propylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111622059 |
| Molecular Formula | C18H29IN4O |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N,N-dimethyl-2-[[[2-(4-methylphenyl)propylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NCC(C)c1ccc(C)cc1.I |
| InChI | InChI=1S/C18H28N4O.HI/c1-6-11-19-18(21-13-17(23)22(4)5)20-12-15(3)16-9-7-14(2)8-10-16;/h6-10,15H,1,11-13H2,2-5H3,(H2,19,20,21);1H |
| InChIKey | NJBQEMQYFUDUNU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|