C16H23F2IN4O — CID 111324281
2-[[[1-(3,4-difluorophenyl)ethylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111324281) has the molecular formula C16H23F2IN4O and a molecular weight of 452.29 g/mol. Its IUPAC name is 2-[[[1-(3,4-difluorophenyl)ethylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[1-(3,4-difluorophenyl)ethylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111324281 |
| Molecular Formula | C16H23F2IN4O |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 2-[[[1-(3,4-difluorophenyl)ethylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NC(C)c1ccc(F)c(F)c1.I |
| InChI | InChI=1S/C16H22F2N4O.HI/c1-5-8-19-16(20-10-15(23)22(3)4)21-11(2)12-6-7-13(17)14(18)9-12;/h5-7,9,11H,1,8,10H2,2-4H3,(H2,19,20,21);1H |
| InChIKey | XGBMIXMFVGMFKJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|