C18H28FIN4O2 — CID 110043632
2-[[[2-(3-fluorophenoxy)butylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110043632) has the molecular formula C18H28FIN4O2 and a molecular weight of 478.35 g/mol. Its IUPAC name is 2-[[[2-(3-fluorophenoxy)butylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[2-(3-fluorophenoxy)butylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110043632 |
| Molecular Formula | C18H28FIN4O2 |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-[[[2-(3-fluorophenoxy)butylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NCC(CC)Oc1cccc(F)c1.I |
| InChI | InChI=1S/C18H27FN4O2.HI/c1-5-10-20-18(22-13-17(24)23(3)4)21-12-15(6-2)25-16-9-7-8-14(19)11-16;/h5,7-9,11,15H,1,6,10,12-13H2,2-4H3,(H2,20,21,22);1H |
| InChIKey | CAYSXPVHOUWLPS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|