C16H22F2N4O — CID 111965777
2-[[[2-(2,5-difluorophenyl)ethylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111965777) has the molecular formula C16H22F2N4O and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[[[2-(2,5-difluorophenyl)ethylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[2-(2,5-difluorophenyl)ethylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111965777 |
| Molecular Formula | C16H22F2N4O |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-[[[2-(2,5-difluorophenyl)ethylamino]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NCCc1cc(F)ccc1F |
| InChI | InChI=1S/C16H22F2N4O/c1-4-8-19-16(21-11-15(23)22(2)3)20-9-7-12-10-13(17)5-6-14(12)18/h4-6,10H,1,7-9,11H2,2-3H3,(H2,19,20,21) |
| InChIKey | MOMNIYMTSLJPNJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|