C17H32IN5O3 — CID 111586858
tert-butyl N-methyl-N-[2-[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111586858) has the molecular formula C17H32IN5O3 and a molecular weight of 481.38 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-methyl-N-[2-[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111586858 |
| Molecular Formula | C17H32IN5O3 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCN(C)C(=O)OC(C)(C)C)NCc1cc(C(C)C)no1.I |
| InChI | InChI=1S/C17H31N5O3.HI/c1-12(2)14-10-13(25-21-14)11-20-15(18-6)19-8-9-22(7)16(23)24-17(3,4)5;/h10,12H,8-9,11H2,1-7H3,(H2,18,19,20);1H |
| InChIKey | XMMAXTMUYPPGFY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|