C19H35N5O3 — CID 109393236
tert-butyl N-[2-[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]-N-propylcarbamate (PubChem CID 109393236) has the molecular formula C19H35N5O3 and a molecular weight of 381.52 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 109393236 |
| Molecular Formula | C19H35N5O3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | tert-butyl N-[2-[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CCN/C(=N\C)NCc1cc(C(C)C)no1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H35N5O3/c1-8-10-24(18(25)26-19(4,5)6)11-9-21-17(20-7)22-13-15-12-16(14(2)3)23-27-15/h12,14H,8-11,13H2,1-7H3,(H2,20,21,22) |
| InChIKey | XRHCAKUCJSCPAF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|