C17H30N4O3 — CID 111585791
methyl 7-[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]heptanoate (PubChem CID 111585791) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is methyl 7-[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]heptanoate.
| Compound Name | methyl 7-[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]heptanoate |
|---|---|
| PubChem CID | 111585791 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | methyl 7-[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]heptanoate |
| SMILES | C/N=C(\NCCCCCCC(=O)OC)NCc1cc(C(C)C)no1 |
| InChI | InChI=1S/C17H30N4O3/c1-13(2)15-11-14(24-21-15)12-20-17(18-3)19-10-8-6-5-7-9-16(22)23-4/h11,13H,5-10,12H2,1-4H3,(H2,18,19,20) |
| InChIKey | CDWDNSWZXKJSSQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|