C18H36N6O4S — CID 110036919
N,N-dimethyl-2-[[[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide (PubChem CID 110036919) has the molecular formula C18H36N6O4S and a molecular weight of 432.59 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110036919 |
| Molecular Formula | C18H36N6O4S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | N,N-dimethyl-2-[[[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(/NCCCN1CCOCC1)NC[C@H]1CCCN1S(C)(=O)=O |
| InChI | InChI=1S/C18H36N6O4S/c1-22(2)17(25)15-21-18(19-7-5-8-23-10-12-28-13-11-23)20-14-16-6-4-9-24(16)29(3,26)27/h16H,4-15H2,1-3H3,(H2,19,20,21)/t16-/m1/s1 |
| InChIKey | UFWIBLXJLVIZON-MRXNPFEDSA-N |
| XLogP | -1.24 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|