C17H33N5O3S — CID 110034039
2-[[(cyclohexylamino)-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110034039) has the molecular formula C17H33N5O3S and a molecular weight of 387.55 g/mol. Its IUPAC name is 2-[[(cyclohexylamino)-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclohexylamino)-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110034039 |
| Molecular Formula | C17H33N5O3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-[[(cyclohexylamino)-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NC[C@H]1CCCN1S(C)(=O)=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H33N5O3S/c1-21(2)16(23)13-19-17(20-14-8-5-4-6-9-14)18-12-15-10-7-11-22(15)26(3,24)25/h14-15H,4-13H2,1-3H3,(H2,18,19,20)/t15-/m1/s1 |
| InChIKey | ZGOXOIGOLSCVDB-OAHLLOKOSA-N |
| XLogP | 0.37 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|