C14H28IN5O3S — CID 110033568
N,N-dimethyl-2-[[[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110033568) has the molecular formula C14H28IN5O3S and a molecular weight of 473.38 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110033568 |
| Molecular Formula | C14H28IN5O3S |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N,N-dimethyl-2-[[[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NC[C@H]1CCCN1S(C)(=O)=O.I |
| InChI | InChI=1S/C14H27N5O3S.HI/c1-5-8-15-14(17-11-13(20)18(2)3)16-10-12-7-6-9-19(12)23(4,21)22;/h5,12H,1,6-11H2,2-4H3,(H2,15,16,17);1H/t12-;/m1./s1 |
| InChIKey | PJZHAPZFMXBRFJ-UTONKHPSSA-N |
| XLogP | -0.16 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|